Luteolin-4'-O-glucoside (Standard) | CAS | 6920-38-3 |
| Molecular Weight | 448.38 |
| Formula | C21H20O11 |
| SMILES | O=C1C(C(OC(C(C=C2)=CC(O)=C2O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]([C@H]3O)CO)=C1)=CC(O)=C4)=C4O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19106 | Wistin | Inquiry |
|
| PDP-17869 | C-2'-Decoumaroylaloeresin G | Inquiry |
|
| PDP-14906 | Andrograpanin | Inquiry |
|
| PDP-14335 | Vincetoxicoside B | Inquiry |
|
| PDP-17370 | 4-O-Methylepisappanol | Inquiry |
|
| PDP-13122 | Beta-Sitosterol (purity>98%) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
