(-)-Corypalmine | Synonyms | Discretinine |
| CAS | 6018-40-2 |
| Molecular Weight | 341.40 |
| Formula | C20H23NO4 |
| SMILES | COC1=C(O)C=C2C([C@@]3([H])N(CC2)CC4=C(OC)C(OC)=CC=C4C3)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17007 | Epifriedelanol Acetate | Inquiry |
|
| PDP-14244 | 3-O-Methylgallic Acid | Inquiry |
|
| PDP-15126 | Cauloside F | Inquiry |
|
| PDP-18465 | Isocucurbitacin B | Inquiry |
|
| PDP-14250 | 6-Ketocholestanol | Inquiry |
|
| PDP-13582 | Forchlorfenuron | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
