Crovatin | CAS | 142409-09-4 |
| Molecular Weight | 374.43 |
| Formula | C21H26O6 |
| SMILES | COC(C1C23C4C5(C(C)CC3)C(OC(C6=COC=C6)C5)OC2OC1CC4)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17618 | Cnidioside B | Inquiry |
|
| PDP-15627 | Fuscaxanthone C | Inquiry |
|
| PDP-15357 | Humantenmine | Inquiry |
|
| PDP-13764 | Chelidonine | Inquiry |
|
| PDP-15088 | N-Caffeoyl O-methyltyramine | Inquiry |
|
| PDP-13808 | Corydaline | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.