Cuparene | Synonyms | (R)-Cuparene |
| CAS | 16982-00-6 |
| Molecular Weight | 202.34 |
| Formula | C15H22 |
| SMILES | CC1(C)[C@@](C2=CC=C(C)C=C2)(C)CCC1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13544 | Nuciferine | Inquiry |
|
| PDP-13893 | Avicularin | Inquiry |
|
| PDP-14026 | Benzoylmesaconine | Inquiry |
|
| PDP-16089 | Chloramultilide B | Inquiry |
|
| PDP-13746 | Sophoraflavanone G | Inquiry |
|
| PDP-13107 | D-Galactose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
