Cyanidin Chloride | CAS No. | 528-58-5 |
| Purity | 98.94% |
| Synonyms | IdB 1027 |
| Molecular Weight | 322.70 |
| Formula | C15H11ClO6 |
| Appearance | Solid |
| Color | Brown to black |
| SMILES | OC1=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O)C=C2C(O)=C1.[Cl-] |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
-20°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24035 | 2-Hydroxygentamicin B | Inquiry |
|
| MDP-12071 | 2'-Aminoacetophenone | Inquiry |
|
| MDP-22931 | 16-Deethylindanomycin | Inquiry |
|
| MDP-11395 | N-Acetyl-L-glutamic Acid | Inquiry |
|
| MDP-10949 | Metronidazole | Inquiry |
|
| MDP-23414 | Leucinostatin H | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
