Cycloastragenol | Synonyms | Astramembrangenin; Cyclosieversigenin |
| Appearance | Solid |
| CAS | 78574-94-4 |
| Purity | ≥98.0% |
| Molecular Weight | 490.72 |
| Formula | C30H50O5 |
| Color | White to off-white |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C3)[C@]43CC[C@]5(C)[C@@H]([C@](C)(O6)CC[C@H]6C(C)(O)C)[C@@H](O)C[C@](C)5[C@]4([H])C[C@H](O)[C@@]12[H] |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13728 | Tubuloside B | Inquiry |
|
| PDP-20233 | Schizozygine | Inquiry |
|
| PDP-19628 | OAT1/3-IN-2 | Inquiry |
|
| PDP-20528 | Apigenin 7-glucoside (Standard) | Inquiry |
|
| PDP-19686 | Linoleyl Alcohol (Standard) | Inquiry |
|
| PDP-18346 | ent-11α-Hydroxy-15-oxokaur-16-en-19-oic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.