Cyclo(Ile-Ala) (Standard) Isoferulic acid (Standard) is the analytical standard for Isoferulic acid, intended for research and analytical purposes. Isoferulic acid (3-Hydroxy-4-methoxycinnamic acid), a cinnamic acid derivative, has antidiabetic effects. It binds to and activates α1-adrenergic receptors (IC₅₀ = 1.4 µM) to enhance β-endorphin secretion (EC50 = 52.2 nM) and improve glucose utilization. Additionally, Isoferulic acid exhibits anti-influenza virus activity.
| CAS No. | 90821-99-1 |
| Molecular Weight | 184.24 |
| Formula | C9H16N2O2 |
| SMILES | O=C(C(C)N1)NC(C(C)CC)C1=O |
| Intended Use | For research use only. |
| Storage | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12884 | Latrunculin M | Inquiry |
|
| MDP-12840 | Diorcinol | Inquiry |
|
| MDP-12908 | Aerophobin-2 | Inquiry |
|
| MDP-12864 | SIRT1 Activator 1 | Inquiry |
|
| MDP-12828 | Methyl Mycophenolate | Inquiry |
|
| MDP-12814 | Bryostatin 1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
