Cyclothialidine B | CAS No. | 194276-76-1 |
| Molecular Weight | 611.62 |
| Formula | C25H33N5O11S |
| SMILES | O=C(N[C@@H](CSCC1=C(O)C=C(O)C=C1C(OC2)=O)C(N[C@@H](C)C(O)=O)=O)[C@H]2NC([C@H]3N(CC[C@H]3O)C([C@@H](N)C)=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22009 | Kanosamine | Inquiry |
|
| MDP-22191 | Dactylocycline A | Inquiry |
|
| MDP-22112 | Phenelfamycin E | Inquiry |
|
| MDP-22347 | Actiphenol | Inquiry |
|
| MDP-11812 | 4'-Hydroxyflavanone | Inquiry |
|
| MDP-23630 | 3,4-Dimethoxytropolone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
