Cytosaminomycin B | CAS No. | 157878-03-0 |
| Molecular Weight | 547.60 |
| Formula | C26H37N5O8 |
| SMILES | O=C1N([C@H]2C[C@H]([C@@H]([C@H](O2)C)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C)N(C)C)O)O)O)C=CC(NC(C4=CC=C(C=C4)NC)=O)=N1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23954 | Megovalicin B | Inquiry |
|
| MDP-22891 | 5-HEPE | Inquiry |
|
| MDP-22393 | Netropsin | Inquiry |
|
| MDP-24132 | Cytochalasin F | Inquiry |
|
| MDP-22798 | Tigecycline (Standard) | Inquiry |
|
| MDP-22123 | 3-Oxo-cinobufagin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
