Cytosporone B | CAS No. | 321661-62-5 |
| Purity | 99.23% |
| Synonyms | Csn-B; Dothiorelone G |
| Molecular Weight | 322.40 |
| Formula | C18H26O5 |
| Appearance | Solid |
| Color | Off-white to light yellow |
| SMILES | O=C(OCC)CC1=CC(O)=CC(O)=C1C(CCCCCCC)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 1 year; -20°C 6 months |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22021 | Luzopeptin A | Inquiry |
|
| MDP-22234 | Vitamin A (Standard) | Inquiry |
|
| MDP-11256 | Glyphosate | Inquiry |
|
| MDP-23060 | Aflavazole | Inquiry |
|
| MDP-23897 | Clavamycin B | Inquiry |
|
| MDP-12469 | Propioxatin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
