Luzopeptin A | CAS No. | 75580-37-9 |
| Synonyms | BBM-928 A |
| Molecular Weight | 1427.38 |
| Formula | C64H78N14O24 |
| SMILES | O=C1N2[C@@](C(NCC(N(CC(N([C@H](C(OC[C@H](C(N3[C@]([C@H](CC=N3)OC(C)=O)([H])C(NCC(N(CC(N([C@H](C(OC[C@H]1NC(C4=NC5=C(C=C(C=C5)OC)C=C4O)=O)=O)C(C)(O)C)C)=O)C)=O)=O)=O)NC(C6=NC7=C(C=C(C=C7)OC)C=C6O)=O)=O)C(C)(O)C)C)=O)C)=O)=O)([H])[C@H](CC=N2)OC(C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22209 | D-Psicose (Standard) | Inquiry |
|
| MDP-12541 | Tirandamycin A | Inquiry |
|
| MDP-22825 | Fasciculic Acid B | Inquiry |
|
| MDP-11812 | 4'-Hydroxyflavanone | Inquiry |
|
| MDP-23836 | Herbimycin B | Inquiry |
|
| MDP-12070 | D-Threitol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
