D-Glucose,6-Benzoate | CAS No. | 14200-76-1 |
| Molecular Formula | C13H16O7 |
| MW | 284.26 |
| Boiling Point | 558.7±50.0ºC(lit.) |
| SMILES | C(OCC(O)C(O)C(O)C(O)C=O)(=O)C1C=CC=CC=1 |
| InchiKey | VKUVHQLMDOUYND-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5481 | Curdlan | Inquiry |
|
| OM-5458 | L-Rhamnose | Inquiry |
|
| OM-5645 | 3-Deoxy-3-Fluoro-D-Mannose | Inquiry |
|
| OM-5661 | L-(+)-Fructose | Inquiry |
|
| OM-5417 | Ferrouslactate Trihydrate | Inquiry |
|
| OM-5708 | Sophorose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
