D-Xylulose | CAS No. | 551-84-8 |
| Purity | 99.90% |
| Molecular Weight | 150.13 |
| Formula | C5H10O5 |
| Appearance | Liquid |
| Color | Colorless to light yellow |
| SMILES | OCC([C@H]([C@@H](CO)O)O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage | Solution, -20°C, 2 years |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12742 | Cytochalasin R | Inquiry |
|
| MDP-22392 | Megastigmatrienone (mixed Isomers) | Inquiry |
|
| MDP-23168 | Maltotriose (Standard) | Inquiry |
|
| MDP-23498 | Agrobactin | Inquiry |
|
| MDP-24283 | Cyclothialidine B | Inquiry |
|
| MDP-24178 | Fomecin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
