Daidzein (Standard) | Appearance | Solid |
| CAS | 486-66-8 |
| Purity | 99.46% |
| Molecular Weight | 254.24 |
| Formula | C₁₅H₁₀O₄ |
| Color | White to off-white |
| SMILES | O=C1C(C2=CC=C(O)C=C2)=COC3=CC(O)=CC=C13 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20443 | Rutaecarpine (Standard) | Inquiry |
|
| PDP-18184 | Maoyerabdosin | Inquiry |
|
| PDP-18144 | Naringenin-4',7-diacetate | Inquiry |
|
| PDP-16500 | Methyl Eugenol (Standard) | Inquiry |
|
| PDP-17100 | Garcinone B | Inquiry |
|
| PDP-15616 | Enmein | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
