De-4'-O-methylyangambin | CAS | 149250-48-6 |
| Molecular Weight | 432.46 |
| Formula | C23H28O8 |
| SMILES | COC1=C(OC)C(OC)=CC([C@@H]2[C@]3([H])[C@@](CO2)([H])[C@@H](C4=CC(OC)=C(C(OC)=C4)O)OC3)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14376 | Isoxanthohumol | Inquiry |
|
| PDP-13865 | Tormentic Acid | Inquiry |
|
| PDP-19508 | Sibiriquinone A | Inquiry |
|
| PDP-14066 | β-Gentiobiose | Inquiry |
|
| PDP-17048 | Magnoloside B | Inquiry |
|
| PDP-19213 | trans-N-Methyl-4-methoxyproline | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
