Dendrophenol | Synonyms | Moscatilin |
| Appearance | Solid |
| CAS | 108853-14-1 |
| Purity | 99.93% |
| Molecular Weight | 304.34 |
| Formula | C17H20O5 |
| Color | White to off-white |
| SMILES | COC1=C(C=CC(CCC2=CC(OC)=C(C(OC)=C2)O)=C1)O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14983 | Steppogenin | Inquiry |
|
| PDP-20309 | 8-Hydroxy-7-methoxycoumarin | Inquiry |
|
| PDP-15430 | Scopoline | Inquiry |
|
| PDP-18826 | Bisabolone Oxide A | Inquiry |
|
| PDP-20219 | (−)-Voacangarine | Inquiry |
|
| PDP-16729 | Meliasenin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
