Meliasenin B | Appearance | Solid |
| CAS | 1221262-77-6 |
| Purity | ≥98.0% |
| Molecular Weight | 468.67 |
| Formula | C30H44O4 |
| Color | White to off-white |
| SMILES | C[C@@]12[C@]([C@@]3([H])[C@](OC([C@@H]3CC/C=C(C)/C)=O)([H])C1)(CC[C@@]4([H])C2=CC([C@]5([H])[C@@]4(CC[C@@H](C5(C)C)O)C)=O)C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15340 | Bellidifolin | Inquiry |
|
| PDP-16834 | Rabdosin B | Inquiry |
|
| PDP-20313 | Nortriptyline (Standard) | Inquiry |
|
| PDP-15564 | Dehydroglaucine | Inquiry |
|
| PDP-19509 | Lignan J1 | Inquiry |
|
| PDP-16898 | Levatin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
