Deoxysappanone B | Synonyms | 3-Deoxysappanone B |
| CAS | 113122-54-6 |
| Molecular Weight | 286.28 |
| Formula | C16H14O5 |
| SMILES | O=C1[C@H](CC2=CC=C(O)C(O)=C2)COC3=CC(O)=CC=C13 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15671 | Malabaricone B | Inquiry |
|
| PDP-13862 | Soyasapogenol B | Inquiry |
|
| PDP-17320 | Salvinolone | Inquiry |
|
| PDP-14294 | Osthenol | Inquiry |
|
| PDP-17291 | 1b-Benzoyl-8a-cinnamoyl-4a,5a-dihydroxydihydroagarofuran | Inquiry |
|
| PDP-19923 | Methylophiopogonone A (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
