Depressine | Synonyms | Depressin |
| Appearance | Solid |
| CAS | 176182-06-2 |
| Purity | 99.84% |
| Molecular Weight | 688.63 |
| Formula | C30H40O18 |
| Color | White to light yellow |
| SMILES | O=C(C1=CO[C@@H](O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)[C@H](C=C)[C@@H]1CCOC(C3=CC=CC(O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)=C3O)=O)OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18810 | Bancroftinone | Inquiry |
|
| PDP-13093 | Chlorophyll Colorant | Inquiry |
|
| PDP-19938 | Brevilin A (Standard) | Inquiry |
|
| PDP-17207 | Gluconasturtiin | Inquiry |
|
| PDP-18703 | Eulophiol | Inquiry |
|
| PDP-18792 | 1-O-Galloyl-2-O-cinnamoyl-glucose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
