Desmethylxanthohumol | Appearance | Solid |
| CAS | 115063-39-3 |
| Purity | 99.66% |
| Molecular Weight | 340.37 |
| Formula | C20H20O5 |
| Color | Yellow to orange |
| SMILES | O=C(C1=C(O)C=C(O)C(C/C=C(C)\C)=C1O)/C=C/C2=CC=C(O)C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16577 | Sinensin | Inquiry |
|
| PDP-17935 | 1-Deacetylnimbolinin B | Inquiry |
|
| PDP-17130 | Sennoside B (Standard) | Inquiry |
|
| PDP-17946 | 2,16-Kauranediol | Inquiry |
|
| PDP-15652 | (-)-Epipodophyllotoxin | Inquiry |
|
| PDP-14226 | Clovamide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
