Destruxin B2 | CAS No. | 79386-00-8 |
| Molecular Weight | 579.73 |
| Formula | C29H49N5O7 |
| SMILES | O=C1N2[C@](CCC2)([H])C(N[C@H](C(N([C@H](C(N([C@H](C(NCCC(O[C@@H]1CC(C)C)=O)=O)C)C)=O)C(C)C)C)=O)C(C)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22982 | Hormaomycin | Inquiry |
|
| MDP-11215 | Diprotin A | Inquiry |
|
| MDP-12082 | L-Alanine (Standard) | Inquiry |
|
| MDP-23912 | Cinatrin B | Inquiry |
|
| MDP-23225 | Undecane (Standard) | Inquiry |
|
| MDP-23450 | Ashimycin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
