Dihydromorin | Appearance | Solid |
| CAS | 18422-83-8 |
| Purity | 99.96% |
| Molecular Weight | 304.25 |
| Formula | C15H12O7 |
| Color | White to off-white |
| SMILES | O=C1C2=C(O)C=C(O)C=C2O[C@H](C3=C(C=C(O)C=C3)O)[C@H]1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14197 | (-)-Maackiain | Inquiry |
|
| PDP-20502 | Asiaticoside (Standard) | Inquiry |
|
| PDP-18704 | Gnetulin | Inquiry |
|
| PDP-18628 | Hydroxyl-γ-isosanshool | Inquiry |
|
| PDP-14862 | Quercetin-3-O-D-glucosyl]-(1-2)-L-rhamnoside | Inquiry |
|
| PDP-14409 | Jolkinolide B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
