Jolkinolide B | Appearance | Solid |
| CAS | 37905-08-1 |
| Purity | 99.12% |
| Molecular Weight | 330.42 |
| Formula | C20H26O4 |
| Color | White to off-white |
| SMILES | C[C@]([C@]1([H])CC2)(CCCC1(C)C)[C@@]([C@@H]3[C@@]4(O5)O3)([H])[C@@]62[C@@H](C4=C(C)C5=O)O6 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20093 | Guanfu Base A Hydrochloride | Inquiry |
|
| PDP-16533 | Nimbin | Inquiry |
|
| PDP-15447 | Scopine | Inquiry |
|
| PDP-18274 | Centrolobol | Inquiry |
|
| PDP-20384 | Forskolin (Standard) | Inquiry |
|
| PDP-16254 | Minimolide F | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
