DL-alpha-Tocopherol | Synonyms | DL-α-Tocopherol |
| Appearance | Liquid (Density: 0.950 g/cm3 ) |
| CAS | 10191-41-0 |
| Purity | 99.84% |
| Molecular Weight | 430.71 |
| Formula | C29H50O2 |
| Color | Light yellow to brown |
| SMILES | CC1=C2C(CCC(CCCC(C)CCCC(C)CCCC(C)C)(C)O2)=C(C)C(O)=C1C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17970 | Deoxysappanone B | Inquiry |
|
| PDP-18036 | 6,8-Diprenylgenistein | Inquiry |
|
| PDP-15255 | Scabertopin | Inquiry |
|
| PDP-19426 | Ptelatoside B | Inquiry |
|
| PDP-15870 | Adoxosidic Acid | Inquiry |
|
| PDP-20257 | (Rac)-Ganoderic Acid C2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
