Drynachromoside A | CAS | 1507388-29-5 |
| Molecular Weight | 500.45 |
| Formula | C22H28O13 |
| SMILES | OC1=C2C(OC(C)=CC2=O)=CC(O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)O)O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19387 | Dehydrodicentrine | Inquiry |
|
| PDP-18207 | Lophanthoidin B | Inquiry |
|
| PDP-18724 | Isorubrofusarin-6-O-β-gentiobioside | Inquiry |
|
| PDP-15879 | Neonuezhenide | Inquiry |
|
| PDP-14068 | Cedrol | Inquiry |
|
| PDP-16449 | Chrysin (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
