Echinoserine | CAS No. | 167324-03-0 |
| Molecular Weight | 1137.29 |
| Formula | C51H68N12O14S2 |
| SMILES | O=C(C(C(C)C)N(C)C(C(CSC(C(N(C)C(C(C)NC(C(CO)NC(C1=NC2=CC=CC=C2N=C1)=O)=O)=O)C(N(C(C(C)C)C(O)=O)C)=O)SC)N(C)C(C(C)NC(C(CO)NC(C3=NC4=CC=CC=C4N=C3)=O)=O)=O)=O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23702 | Saframycin D | Inquiry |
|
| MDP-23871 | Elsamicin B | Inquiry |
|
| MDP-22718 | Oxychlororaphine (Standard) | Inquiry |
|
| MDP-24033 | Cytotrienin A | Inquiry |
|
| MDP-12691 | Ganodermaones B | Inquiry |
|
| MDP-11830 | Nonanal | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
