Eicosapentaenoic Acid Methyl Ester | Appearance | Liquid (Density: 0.912±0.06 g/cm3) |
| CAS | 2734-47-6 |
| Purity | 99.11% |
| Molecular Weight | 316.49 |
| Formula | C21H32O2 |
| Color | Colorless to light yellow |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(OC)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17653 | Donasine | Inquiry |
|
| PDP-13551 | Crocetin | Inquiry |
|
| PDP-20080 | Apoatropine | Inquiry |
|
| PDP-15192 | 2-(2-Phenylethyl)chromone | Inquiry |
|
| PDP-15692 | 13-Oxyingenol-13-dodecanoate | Inquiry |
|
| PDP-18679 | (R)-Eucomol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
