Emodin | CAS No. | 518-82-1 |
| Purity | 99.25% |
| Synonyms | Frangula Emodin |
| Molecular Weight | 270.24 |
| Formula | C15H10O5 |
| Appearance | Solid |
| Color | Yellow to orange |
| SMILES | O=C1C2=C(C=C(C)C=C2O)C(C3=CC(O)=CC(O)=C31)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 1 year; -20°C 6 months |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11278 | Orotic Acid | Inquiry |
|
| MDP-22296 | Quercitrin (Standard) | Inquiry |
|
| MDP-12259 | Rhamnose (monohydrate) (Standard) | Inquiry |
|
| MDP-23618 | Trichomycin B | Inquiry |
|
| MDP-23518 | Adiposin | Inquiry |
|
| MDP-22220 | Propioxatin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
