Epelmycin E | CAS No. | 76264-93-2 |
| Molecular Weight | 827.87 |
| Formula | C42H53NO16 |
| SMILES | COC([C@@H]([C@](O)(C1)CC)C(C(O)=C2C(C(C3=C(O)C=CC=C3C2=O)=O)=C4O)=C4[C@H]1O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O[C@H]6C[C@@H]([C@@H]([C@@H](O6)C)O[C@@H]7O[C@H](C(CC7)=O)C)O)N(C)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12683 | Anserinone B | Inquiry |
|
| MDP-11051 | L-Serine | Inquiry |
|
| MDP-24346 | Saframycin E | Inquiry |
|
| MDP-10968 | Vancomycin Hydrochloride | Inquiry |
|
| MDP-24080 | Cetoniacytone B | Inquiry |
|
| MDP-22388 | Deoxynivalenol (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
