Epidermin | CAS No. | 99165-17-0 |
| Molecular Weight | 2165.58 |
| Formula | C98H141N25O23S4 |
| SMILES | O=C(C[C@@H]1NC([C@H](CC2=CC=CC=C2)NC([C@@H](CSC[C@@H]3NC([C@H](CC4=CC=C(C=C4)O)NC([C@@H](CS/C=C\NC3=O)NC1=O)=O)=O)NC(CNC(/C(NC([C@H](CCCCN)NC([C@H](C)NC([C@H]5NC(CNC([C@H]6N(CCC6)C([C@@H]([C@H](C)SC5)NC([C@H]7NC([C@H]([C@H](CC)C)NC([C@H](CC8=CC=CC=C8)NC([C@H](CCCCN)NC([C@@H](CSC7)NC([C@H](C)NC([C@H]([C@H](CC)C)N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=C/C)=O)=O)=O)=O)N |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22971 | Kinamycin B | Inquiry |
|
| MDP-23428 | Aplasmomycin | Inquiry |
|
| MDP-23925 | Darlucin B | Inquiry |
|
| MDP-10996 | Deoxycholic Acid | Inquiry |
|
| MDP-22125 | 3-Oxo-bufalin | Inquiry |
|
| MDP-11500 | Lincomycin Hydrochloride Monohydrate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
