Epiderstatin | CAS No. | 126602-16-2 |
| Molecular Weight | 292.33 |
| Formula | C15H20N2O4 |
| SMILES | O=C(NC(C1)=O)CC1CC(/C=C2[C@H](C[C@@H](C(N/2)=O)C)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23083 | Rubomycin H | Inquiry |
|
| MDP-22922 | M145724 | Inquiry |
|
| MDP-11992 | Pantolactone | Inquiry |
|
| MDP-11047 | Creatine | Inquiry |
|
| MDP-22890 | Allolactose | Inquiry |
|
| MDP-24011 | Rhodomycin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
