Epimedin A (Standard) | CAS | 110623-72-8 |
| Molecular Weight | 838.80 |
| Formula | C₃₉H₅₀O₂₀ |
| SMILES | O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](OC2=CC(O)=C(C(C(O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O[C@@]4([H])[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)=C(C5=CC=C(OC)C=C5)O6)=O)C6=C2C/C=C(C)/C)[C@@H]1O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19230 | Diselaginellin B | Inquiry |
|
| PDP-13619 | Picroside II | Inquiry |
|
| PDP-16677 | Obtusin | Inquiry |
|
| PDP-18472 | Acetyl Perisesaccharide C | Inquiry |
|
| PDP-17304 | AChE/BChE-IN-11 | Inquiry |
|
| PDP-17487 | Epimedonin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
