Eremofortin B | CAS No. | 60048-73-9 |
| Molecular Weight | 248.32 |
| Formula | C15H20O3 |
| SMILES | O=C(C=C12)[C@H](C(C)=C)C[C@]1(C)[C@@H](C)[C@@H](O)[C@]3([H])[C@@]2([H])O3 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23515 | Alliacol A | Inquiry |
|
| MDP-11740 | Hygromycin A | Inquiry |
|
| MDP-11797 | Tylosin Tartrate | Inquiry |
|
| MDP-12135 | Gentisyl Alcohol | Inquiry |
|
| MDP-22073 | Sydowinin B | Inquiry |
|
| MDP-11554 | Ornidazole | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
