Eurocidin D | CAS No. | 130433-01-1 |
| Molecular Weight | 795.91 |
| Formula | C40H61NO15 |
| SMILES | O=C(C1C2CC(O[C@H]3[C@H]([C@@H](N)[C@@H]([C@@H](C)O3)O)O)/C=C\C=C\C=C/C=C/C=C/CC(C(C)CC)OC(CC(O)CC(CCC(O)C(O)CC(O2)(O)CC1O)=O)=O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22942 | Fructigenine A | Inquiry |
|
| MDP-22950 | (+)-Oxanthromicin | Inquiry |
|
| MDP-22127 | Fosmidomycin | Inquiry |
|
| MDP-22965 | Chevalone B | Inquiry |
|
| MDP-11330 | 12-Ketodeoxycholic Acid | Inquiry |
|
| MDP-23912 | Cinatrin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
