Fargesone B | CAS | 116424-70-5 |
| Molecular Weight | 372.41 |
| Formula | C21H24O6 |
| SMILES | CO[C@]12[C@](O[C@H](C3=CC=C(OCO4)C4=C3)[C@H]2C)([H])[C@H](C(C=C1OC)=O)CC=C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16053 | Rebaudioside G | Inquiry |
|
| PDP-14636 | Uvaol | Inquiry |
|
| PDP-15661 | Tortoside A | Inquiry |
|
| PDP-13865 | Tormentic Acid | Inquiry |
|
| PDP-17036 | Debilon | Inquiry |
|
| PDP-19744 | Daphnetin (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
