Fasciculic Acid B | CAS No. | 126882-55-1 |
| Molecular Weight | 636.86 |
| Formula | C36H60O9 |
| SMILES | CC1([C@H]([C@@H](C[C@@]2(C3=C(CC[C@@]12[H])[C@]4(C)CC[C@H]([C@@H](CC[C@H](C(O)(C)C)O)C)[C@@]4(C)[C@H](C3)O)C)OC(CC(O)(CC(O)=O)C)=O)O)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22997 | Nannochelin A | Inquiry |
|
| MDP-22774 | D-Glutamine (Standard) | Inquiry |
|
| MDP-24003 | Glucopiericidin B | Inquiry |
|
| MDP-11239 | Skatole | Inquiry |
|
| MDP-23456 | Arylomycin B3 | Inquiry |
|
| MDP-24106 | 1-Deamino-1-hydroxygentamicin C2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
