Ferroptosis-IN-1 | Molecular Weight | 378.50 |
| Formula | C22H34O5 |
| SMILES | C[C@@]1([C@@H](C[C@@H]([C@]2([C@@]3(CCC[C@@]21[H])O[C@@](C)(OC3)O)C)O)C)CCC4=COC=C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19312 | Hosenkoside B | Inquiry |
|
| PDP-13199 | Withaferin A | Inquiry |
|
| PDP-15745 | (S)-(-)-Citronellal | Inquiry |
|
| PDP-18447 | Neotriptophenolide | Inquiry |
|
| PDP-13906 | Jatrorrhizine Chloride | Inquiry |
|
| PDP-15956 | Littorine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
