Littorine | CAS | 21956-47-8 |
| Molecular Weight | 289.37 |
| Formula | C17H23NO3 |
| SMILES | CN1[C@@]2([H])C[C@@H](C[C@]1([H])CC2)OC([C@H](O)CC3=CC=CC=C3)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13857 | Tussilagone | Inquiry |
|
| PDP-19475 | trans-3,4,5-Trimethoxycinnamyl Alcohol | Inquiry |
|
| PDP-18818 | Kushenol M | Inquiry |
|
| PDP-16102 | Erysubin B | Inquiry |
|
| PDP-19494 | Protocatechuic Acid 3-O-β-D-glucopyranoside | Inquiry |
|
| PDP-15878 | Methyl Dehydroabietate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
