Flavin Adenine Dinucleotide | CAS No. | 146-14-5 |
| Purity | 99.13% |
| Synonyms | FAD |
| Molecular Weight | 785.55 |
| Formula | C27H33N9O15P2 |
| Appearance | Solid |
| Color | Yellow to orange |
| SMILES | CC1=CC(N=C2C(N3)=O)=C(C=C1C)N(C[C@@H]([C@@H]([C@@H](COP(O)(OP(O)(OC[C@H]4O[C@@H](N5C=NC6=C(N=CN=C56)N)[C@@H]([C@@H]4O)O)=O)=O)O)O)O)C2=NC3=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24136 | 5-Hydroxymethylblasticidin S | Inquiry |
|
| MDP-22304 | Maltopentaose (Standard) | Inquiry |
|
| MDP-22966 | Lagunamycin | Inquiry |
|
| MDP-22968 | Racemomycin B | Inquiry |
|
| MDP-24380 | Acivicin Hydrochloride (Standard) | Inquiry |
|
| MDP-23988 | Oxamicetin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
