Folinic Acid | Synonyms | leucovorin |
| Appearance | Solid |
| CAS | 58-05-9 |
| Purity | 99.98% |
| Molecular Weight | 473.44 |
| Formula | C20H23N7O7 |
| Color | Off-white to light yellow |
| SMILES | O=C(O)CC[C@@H](C(O)=O)NC(C1=CC=C(NCC2N(C=O)C3=C(N=C(N)NC3=O)NC2)C=C1)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light, stored under nitrogen In solvent: -80°C, 1 year; -20°C, 6 months (protect from light, stored under nitrogen) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14615 | Parishin E | Inquiry |
|
| PDP-15495 | Danshenol A | Inquiry |
|
| PDP-14203 | 2,5-Furandimethanol | Inquiry |
|
| PDP-18654 | Yadanzioside L | Inquiry |
|
| PDP-19928 | Oroxylin A-7-O-glucuronide (Standard) | Inquiry |
|
| PDP-18229 | Kaerophyllin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
