Fraxinellone | Appearance | Solid |
| CAS | 28808-62-0 |
| Purity | 99.99% |
| Molecular Weight | 232.28 |
| Formula | C14H16O3 |
| Color | White to off-white |
| SMILES | O=C1O[C@@H](C2=COC=C2)[C@]3(C)CCCC(C)=C31 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15221 | Xanthorrhizol | Inquiry |
|
| PDP-16395 | Pinostrobin Chalcone | Inquiry |
|
| PDP-18432 | Homopterocarpin | Inquiry |
|
| PDP-16366 | (-)-Oxypeucedanin Hydrate | Inquiry |
|
| PDP-16778 | Brachyoside B | Inquiry |
|
| PDP-14665 | (±)-Evodiamine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
