Glucoallosamidin A | CAS No. | 136236-41-4 |
| Molecular Weight | 636.65 |
| Formula | C26H44N4O14 |
| SMILES | OC[C@H]1[C@@]2([H])[C@@](N=C(O2)N(C)C)([H])[C@H]([C@@H]1O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O[C@H]4[C@@H]([C@@H]([C@@H]([C@H](O4)COC)O)O)NC(C)=O)O)NC(C)=O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12641 | 9-Demethyl FR-901235 | Inquiry |
|
| MDP-23581 | Decarestrictin M | Inquiry |
|
| MDP-22611 | Nanchangmycin (Standard) | Inquiry |
|
| MDP-21977 | Methyl Lucidenate Q | Inquiry |
|
| MDP-23328 | Kibdelone B | Inquiry |
|
| MDP-24014 | Griseochelin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
