Glycitin | Synonyms | Glycitein 7-O-β-glucoside |
| Appearance | Solid |
| CAS | 40246-10-4 |
| Purity | 99.71% |
| Molecular Weight | 446.40 |
| Formula | C22H22O10 |
| Color | White to off-white |
| SMILES | O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](OC2=CC(OC=C(C3=CC=C(O)C=C3)C4=O)=C4C=C2OC)[C@@H]1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14500 | Cearoin | Inquiry |
|
| PDP-19092 | 1-(3-(1-Hydroxy-3-methylbutyl)-4-methoxyphenyl)ethan-1-one | Inquiry |
|
| PDP-17402 | Withasomniferolide B | Inquiry |
|
| PDP-13851 | Moringin | Inquiry |
|
| PDP-18872 | Nepetoidin B | Inquiry |
|
| PDP-15635 | 3'-O-Acetylhamaudol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
