Glycoperine | CAS | 55740-45-9 |
| Molecular Weight | 391.37 |
| Formula | C19H21NO8 |
| SMILES | COC1=C(C=CO2)C2=NC(C1=CC=C3O[C@H](O[C@H]4C)[C@@H]([C@@H]([C@H]4O)O)O)=C3OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17046 | Kansuinine B | Inquiry |
|
| PDP-19471 | Vitexin Caffeate | Inquiry |
|
| PDP-19310 | Hosenkoside M | Inquiry |
|
| PDP-15448 | Ingenol-3,4,5,20-diacetonide | Inquiry |
|
| PDP-13712 | Cafestol | Inquiry |
|
| PDP-14210 | Sulforaphene | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
