Ingenol-3,4,5,20-diacetonide | Synonyms | Ingenol 3,4:5,20-bisacetonide |
| Appearance | Solid |
| CAS | 77573-44-5 |
| Purity | 99.07% |
| Molecular Weight | 428.56 |
| Formula | C26H36O5 |
| Color | White to off-white |
| SMILES | O=C1[C@@]2(C=C(C)C3OC(C)(C)O4)C34C(OC(C)(C)OC5)C5=C[C@@H]1[C@@H](C6(C)C)[C@@H]6CC2C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20238 | Dihydrocubebin | Inquiry |
|
| PDP-15399 | Quinine Hemisulfate Hydrate | Inquiry |
|
| PDP-13327 | Catalpol | Inquiry |
|
| PDP-15687 | Licoflavone B | Inquiry |
|
| PDP-16277 | Kaempferol 3-O-(2''-O-α-rhamnosyl-6''-O-malonyl-β-glucoside) | Inquiry |
|
| PDP-13307 | β-Carotene | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
