Griseofulvin | CAS No. | 126-07-8 |
| Purity | 99.05% |
| Molecular Weight | 352.77 |
| Formula | C17H17ClO6 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C1[C@]2(C(OC)=CC(C[C@H]2C)=O)OC3=C(Cl)C(OC)=CC(OC)=C13 |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22516 | 9-Dehydroxyeurotinone | Inquiry |
|
| MDP-22550 | Fistupyrone | Inquiry |
|
| MDP-23342 | Endocrocin | Inquiry |
|
| MDP-24012 | Pyripyropene B | Inquiry |
|
| MDP-24197 | Glucolipsin B | Inquiry |
|
| MDP-12060 | 2-Methoxybenzoic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
