Harmine Hydrochloride | Synonyms | Telepathine Hydrochloride |
| Appearance | Solid |
| CAS | 343-27-1 |
| Purity | 99.98% |
| Molecular Weight | 248.71 |
| Formula | C13H13ClN2O |
| Color | Off-white to light yellow |
| SMILES | CC1=NC=CC2=C1NC3=C2C=CC(OC)=C3.Cl |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18383 | Furowanin A | Inquiry |
|
| PDP-17559 | Arabelline | Inquiry |
|
| PDP-19099 | 3'-Deoxy-4-O-methylsappanol | Inquiry |
|
| PDP-13920 | Pseudoprotodioscin | Inquiry |
|
| PDP-15628 | Ginsenoside Rg4 | Inquiry |
|
| PDP-14901 | 12-Deoxywithastramonolide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
