Pseudoprotodioscin | Appearance | Solid |
| CAS | 102115-79-7 |
| Purity | 98.76% |
| Molecular Weight | 1031.18 |
| Formula | C51H82O21 |
| Color | Off-white to light yellow |
| SMILES | C[C@@]1([C@](C(C)=C(CC[C@@H](C)CO[C@@H]([C@@H]([C@@H](O)[C@@H]2O)O)O[C@@H]2CO)O3)([H])[C@]3([H])C4)[C@]4([H])[C@@](CC=C5[C@@]6(CC[C@H](O[C@@](O[C@H](CO)[C@@H](O[C@@](O[C@@H](C)[C@H](O)[C@H]7O)([H])[C@@H]7O)[C@@H]8O)([H])[C@@H]8O[C@@](O[C@@H](C)[C@H](O)[C@H]9O)([H])[C@@H]9O)C5)C)([H])[C@]6([H])CC1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14458 | Licoisoflavone A | Inquiry |
|
| PDP-18922 | Noroxyhydrastinine | Inquiry |
|
| PDP-15452 | Glucosinalbate | Inquiry |
|
| PDP-14013 | Trilobatin | Inquiry |
|
| PDP-20009 | Luteolin-4'-O-glucoside (Standard) | Inquiry |
|
| PDP-15146 | Flaconitine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
