Helichrysetin | Appearance | Solid |
| CAS | 62014-87-3 |
| Purity | 99.92% |
| Molecular Weight | 286.28 |
| Formula | C16H14O5 |
| Color | White to yellow |
| SMILES | O=C(C1=C(OC)C=C(O)C=C1O)/C=C/C2=CC=C(O)C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17125 | Albaspidin AA | Inquiry |
|
| PDP-18215 | Ligucyperonol | Inquiry |
|
| PDP-19897 | Sibiricose A5 (Standard) | Inquiry |
|
| PDP-19918 | Menthone (Standard) | Inquiry |
|
| PDP-19045 | Sanggenofuran B | Inquiry |
|
| PDP-19384 | Pterisolic Acid A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
