Hispaglabridin A | CAS | 68978-03-0 |
| Molecular Weight | 392.49 |
| Formula | C25H28O4 |
| SMILES | CC1(OC2=C(C=C1)C3=C(C=C2)C[C@H](C4=C(C(C/C=C(C)\C)=C(C=C4)O)O)CO3)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18587 | Caulophylline B | Inquiry |
|
| PDP-16839 | 1-Hydroxy-N-methylacridone | Inquiry |
|
| PDP-17050 | Laurycolactone A | Inquiry |
|
| PDP-13798 | Lobeline Hydrochloride | Inquiry |
|
| PDP-17028 | Esculentoside C | Inquiry |
|
| PDP-19935 | Isorhapontigenin (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
